C34H53NO2 — CID 142157435
(16R,17S)-11-hydroxy-10,13,16-trimethyl-17-[(E)-1-(8-methylnon-8-enylamino)but-1-enyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 142157435) has the molecular formula C34H53NO2 and a molecular weight of 507.80 g/mol. Its IUPAC name is (16R,17S)-11-hydroxy-10,13,16-trimethyl-17-[(E)-1-(8-methylnon-8-enylamino)but-1-enyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (16R,17S)-11-hydroxy-10,13,16-trimethyl-17-[(E)-1-(8-methylnon-8-enylamino)but-1-enyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 142157435 |
| Molecular Formula | C34H53NO2 |
| Molecular Weight | 507.80 g/mol |
| Exact Mass | 507.41 |
| IUPAC Name | (16R,17S)-11-hydroxy-10,13,16-trimethyl-17-[(E)-1-(8-methylnon-8-enylamino)but-1-enyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=C(C)CCCCCCCN/C(=C/CC)[C@H]1[C@H](C)CC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC21C |
| InChI | InChI=1S/C34H53NO2/c1-7-13-29(35-19-12-10-8-9-11-14-23(2)3)31-24(4)20-28-27-16-15-25-21-26(36)17-18-33(25,5)32(27)30(37)22-34(28,31)6/h13,17-18,21,24,27-28,30-32,35,37H,2,7-12,14-16,19-20,22H2,1,3-6H3/b29-13+/t24-,27?,28?,30?,31-,32?,33?,34?/m1/s1 |
| InChIKey | FAVUFIQMIMDMST-XLSALWQMSA-N |
| XLogP | 7.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.80 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|