C30H34ClN5S — CID 145170267
2-N-[5-[2-(benzylamino)ethyl]-2-ethylphenyl]-5-chloro-4-N-(2-propan-2-ylsulfanylphenyl)pyrimidine-2,4-diamine (PubChem CID 145170267) has the molecular formula C30H34ClN5S and a molecular weight of 532.16 g/mol. Its IUPAC name is 2-N-[5-[2-(benzylamino)ethyl]-2-ethylphenyl]-5-chloro-4-N-(2-propan-2-ylsulfanylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[5-[2-(benzylamino)ethyl]-2-ethylphenyl]-5-chloro-4-N-(2-propan-2-ylsulfanylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 145170267 |
| Molecular Formula | C30H34ClN5S |
| Molecular Weight | 532.16 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | 2-N-[5-[2-(benzylamino)ethyl]-2-ethylphenyl]-5-chloro-4-N-(2-propan-2-ylsulfanylphenyl)pyrimidine-2,4-diamine |
| SMILES | CCc1ccc(CCNCc2ccccc2)cc1Nc1ncc(Cl)c(Nc2ccccc2SC(C)C)n1 |
| InChI | InChI=1S/C30H34ClN5S/c1-4-24-15-14-22(16-17-32-19-23-10-6-5-7-11-23)18-27(24)35-30-33-20-25(31)29(36-30)34-26-12-8-9-13-28(26)37-21(2)3/h5-15,18,20-21,32H,4,16-17,19H2,1-3H3,(H2,33,34,35,36) |
| InChIKey | ZUIPTBOWOSMVGK-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.16 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|