C10H10Br2N2O — CID 145171963
N-(2,4-dibromophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine (PubChem CID 145171963) has the molecular formula C10H10Br2N2O and a molecular weight of 334.01 g/mol. Its IUPAC name is N-(2,4-dibromophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine.
| Compound Name | N-(2,4-dibromophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine |
|---|---|
| PubChem CID | 145171963 |
| Molecular Formula | C10H10Br2N2O |
| Molecular Weight | 334.01 g/mol |
| Exact Mass | 331.92 |
| IUPAC Name | N-(2,4-dibromophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine |
| SMILES | Brc1ccc(NC2=NCCOC2)c(Br)c1 |
| InChI | InChI=1S/C10H10Br2N2O/c11-7-1-2-9(8(12)5-7)14-10-6-15-4-3-13-10/h1-2,5H,3-4,6H2,(H,13,14) |
| InChIKey | LACUJDRKLREOJO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.01 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |