C31H22F3NO3 — CID 145174974
2-(naphthalen-2-ylamino)-5-[2-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]benzoic acid (PubChem CID 145174974) has the molecular formula C31H22F3NO3 and a molecular weight of 513.52 g/mol. Its IUPAC name is 2-(naphthalen-2-ylamino)-5-[2-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]benzoic acid.
| Compound Name | 2-(naphthalen-2-ylamino)-5-[2-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 145174974 |
| Molecular Formula | C31H22F3NO3 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | 2-(naphthalen-2-ylamino)-5-[2-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]benzoic acid |
| SMILES | O=C(O)c1cc(-c2ccccc2COc2cccc(C(F)(F)F)c2)ccc1Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C31H22F3NO3/c32-31(33,34)24-9-5-10-26(18-24)38-19-23-8-3-4-11-27(23)22-13-15-29(28(17-22)30(36)37)35-25-14-12-20-6-1-2-7-21(20)16-25/h1-18,35H,19H2,(H,36,37) |
| InChIKey | UGOQVMHXBHNKHF-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |