C35H52N6O8 — CID 145175184
[4-[[(2S)-5-amino-2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylimino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl N-[3-[(2-methylpropan-2-yl)oxy]propyl]carbamate (PubChem CID 145175184) has the molecular formula C35H52N6O8 and a molecular weight of 684.84 g/mol. Its IUPAC name is [4-[[(2S)-5-amino-2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylimino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl N-[3-[(2-methylpropan-2-yl)oxy]propyl]carbamate.
| Compound Name | [4-[[(2S)-5-amino-2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylimino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl N-[3-[(2-methylpropan-2-yl)oxy]propyl]carbamate |
|---|---|
| PubChem CID | 145175184 |
| Molecular Formula | C35H52N6O8 |
| Molecular Weight | 684.84 g/mol |
| Exact Mass | 684.38 |
| IUPAC Name | [4-[[(2S)-5-amino-2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylimino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl N-[3-[(2-methylpropan-2-yl)oxy]propyl]carbamate |
| SMILES | CC(C)/C(=N\C(=O)CCCCCN1C(=O)C=CC1=O)C(=O)N[C@@H](CCCN)C(=O)Nc1ccc(COC(=O)NCCCOC(C)(C)C)cc1 |
| InChI | InChI=1S/C35H52N6O8/c1-24(2)31(40-28(42)12-7-6-8-21-41-29(43)17-18-30(41)44)33(46)39-27(11-9-19-36)32(45)38-26-15-13-25(14-16-26)23-48-34(47)37-20-10-22-49-35(3,4)5/h13-18,24,27H,6-12,19-23,36H2,1-5H3,(H,37,47)(H,38,45)(H,39,46)/b40-31+/t27-/m0/s1 |
| InChIKey | SJMNUXLNJZELFZ-WWXJYELYSA-N |
| XLogP | 3.39 |
| TPSA | 198.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.84 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|