C18H29N3 — CID 145176283
methanamine;2-[(E)-2-phenylethenyl]-N-(piperidin-4-ylmethyl)cyclopropan-1-amine (PubChem CID 145176283) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is methanamine;2-[(E)-2-phenylethenyl]-N-(piperidin-4-ylmethyl)cyclopropan-1-amine.
| Compound Name | methanamine;2-[(E)-2-phenylethenyl]-N-(piperidin-4-ylmethyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 145176283 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | methanamine;2-[(E)-2-phenylethenyl]-N-(piperidin-4-ylmethyl)cyclopropan-1-amine |
| SMILES | C(=C/C1CC1NCC1CCNCC1)\c1ccccc1.CN |
| InChI | InChI=1S/C17H24N2.CH5N/c1-2-4-14(5-3-1)6-7-16-12-17(16)19-13-15-8-10-18-11-9-15;1-2/h1-7,15-19H,8-13H2;2H2,1H3/b7-6+; |
| InChIKey | VKFKFKKBOHOYRW-UHDJGPCESA-N |
| XLogP | 2.25 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |