C17H26Cl2N2 — CID 153307593
2-(2-phenylethenyl)-N-(piperidin-4-ylmethyl)cyclopropan-1-amine;dihydrochloride (PubChem CID 153307593) has the molecular formula C17H26Cl2N2 and a molecular weight of 329.31 g/mol. Its IUPAC name is 2-(2-phenylethenyl)-N-(piperidin-4-ylmethyl)cyclopropan-1-amine;dihydrochloride.
| Compound Name | 2-(2-phenylethenyl)-N-(piperidin-4-ylmethyl)cyclopropan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 153307593 |
| Molecular Formula | C17H26Cl2N2 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-(2-phenylethenyl)-N-(piperidin-4-ylmethyl)cyclopropan-1-amine;dihydrochloride |
| SMILES | C(=CC1CC1NCC1CCNCC1)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C17H24N2.2ClH/c1-2-4-14(5-3-1)6-7-16-12-17(16)19-13-15-8-10-18-11-9-15;;/h1-7,15-19H,8-13H2;2*1H |
| InChIKey | QYIABICCJKMKJH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |