C10H14N2O3 — CID 145181337
[4,5-dimethoxy-2-(methylideneamino)phenoxy]methanamine (PubChem CID 145181337) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is [4,5-dimethoxy-2-(methylideneamino)phenoxy]methanamine.
| Compound Name | [4,5-dimethoxy-2-(methylideneamino)phenoxy]methanamine |
|---|---|
| PubChem CID | 145181337 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | [4,5-dimethoxy-2-(methylideneamino)phenoxy]methanamine |
| SMILES | C=Nc1cc(OC)c(OC)cc1OCN |
| InChI | InChI=1S/C10H14N2O3/c1-12-7-4-9(13-2)10(14-3)5-8(7)15-6-11/h4-5H,1,6,11H2,2-3H3 |
| InChIKey | BHPQBJGIMIYTOE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|