C25H30N6O3 — CID 145187441
methyl (E)-N-methyl-2-[[4-oxo-3-propan-2-yl-5-[3-(prop-2-enoylamino)phenyl]imidazo[4,5-c]pyridin-7-yl]amino]pent-2-enimidate (PubChem CID 145187441) has the molecular formula C25H30N6O3 and a molecular weight of 462.55 g/mol. Its IUPAC name is methyl (E)-N-methyl-2-[[4-oxo-3-propan-2-yl-5-[3-(prop-2-enoylamino)phenyl]imidazo[4,5-c]pyridin-7-yl]amino]pent-2-enimidate.
| Compound Name | methyl (E)-N-methyl-2-[[4-oxo-3-propan-2-yl-5-[3-(prop-2-enoylamino)phenyl]imidazo[4,5-c]pyridin-7-yl]amino]pent-2-enimidate |
|---|---|
| PubChem CID | 145187441 |
| Molecular Formula | C25H30N6O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | methyl (E)-N-methyl-2-[[4-oxo-3-propan-2-yl-5-[3-(prop-2-enoylamino)phenyl]imidazo[4,5-c]pyridin-7-yl]amino]pent-2-enimidate |
| SMILES | C=CC(=O)Nc1cccc(-n2cc(NC(=C/CC)/C(=N/C)OC)c3ncn(C(C)C)c3c2=O)c1 |
| InChI | InChI=1S/C25H30N6O3/c1-7-10-19(24(26-5)34-6)29-20-14-30(18-12-9-11-17(13-18)28-21(32)8-2)25(33)23-22(20)27-15-31(23)16(3)4/h8-16,29H,2,7H2,1,3-6H3,(H,28,32)/b19-10+,26-24- |
| InChIKey | AZNNPHVMGWOUDI-RIYSMBBASA-N |
| XLogP | 4.27 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|