C17H20ClFN4O2 — CID 145196100
2-[3-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]pyridine-3-carboxamide;hydrochloride (PubChem CID 145196100) has the molecular formula C17H20ClFN4O2 and a molecular weight of 366.82 g/mol. Its IUPAC name is 2-[3-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]pyridine-3-carboxamide;hydrochloride.
| Compound Name | 2-[3-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]pyridine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 145196100 |
| Molecular Formula | C17H20ClFN4O2 |
| Molecular Weight | 366.82 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 2-[3-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]pyridine-3-carboxamide;hydrochloride |
| SMILES | COc1cc(F)ccc1C1CN(c2ncccc2C(N)=O)CCN1.Cl |
| InChI | InChI=1S/C17H19FN4O2.ClH/c1-24-15-9-11(18)4-5-12(15)14-10-22(8-7-20-14)17-13(16(19)23)3-2-6-21-17;/h2-6,9,14,20H,7-8,10H2,1H3,(H2,19,23);1H |
| InChIKey | QACGLPZNSBNOLI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.82 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |