C22H23NS — CID 145198857
(3R)-3-methyl-N-[2-(1-phenylethenyl)-1-benzothiophen-3-yl]pentan-2-imine (PubChem CID 145198857) has the molecular formula C22H23NS and a molecular weight of 333.50 g/mol. Its IUPAC name is (3R)-3-methyl-N-[2-(1-phenylethenyl)-1-benzothiophen-3-yl]pentan-2-imine.
| Compound Name | (3R)-3-methyl-N-[2-(1-phenylethenyl)-1-benzothiophen-3-yl]pentan-2-imine |
|---|---|
| PubChem CID | 145198857 |
| Molecular Formula | C22H23NS |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (3R)-3-methyl-N-[2-(1-phenylethenyl)-1-benzothiophen-3-yl]pentan-2-imine |
| SMILES | C=C(c1ccccc1)c1sc2ccccc2c1/N=C(\C)[C@H](C)CC |
| InChI | InChI=1S/C22H23NS/c1-5-15(2)17(4)23-21-19-13-9-10-14-20(19)24-22(21)16(3)18-11-7-6-8-12-18/h6-15H,3,5H2,1-2,4H3/b23-17+/t15-/m1/s1 |
| InChIKey | ZUSAZMBUDCBICB-UBJVEFMGSA-N |
| XLogP | 7.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|