C12H19NO — CID 145200826
(3aE,5Z,9E)-2-methyl-2,3,7,8-tetrahydrocycloocta[d][1,3]oxazole;ethane (PubChem CID 145200826) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (3aE,5Z,9E)-2-methyl-2,3,7,8-tetrahydrocycloocta[d][1,3]oxazole;ethane.
| Compound Name | (3aE,5Z,9E)-2-methyl-2,3,7,8-tetrahydrocycloocta[d][1,3]oxazole;ethane |
|---|---|
| PubChem CID | 145200826 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (3aE,5Z,9E)-2-methyl-2,3,7,8-tetrahydrocycloocta[d][1,3]oxazole;ethane |
| SMILES | CC.CC1NC2=C/C=C\CC/C=C\2O1 |
| InChI | InChI=1S/C10H13NO.C2H6/c1-8-11-9-6-4-2-3-5-7-10(9)12-8;1-2/h2,4,6-8,11H,3,5H2,1H3;1-2H3/b4-2-,9-6+,10-7+; |
| InChIKey | STFQSCBDBQSQFL-OTWIQNSRSA-N |
| XLogP | 3.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |