C10H13NO — CID 145200827
(3aE,5Z,9E)-2-methyl-2,3,7,8-tetrahydrocycloocta[d][1,3]oxazole (PubChem CID 145200827) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is (3aE,5Z,9E)-2-methyl-2,3,7,8-tetrahydrocycloocta[d][1,3]oxazole.
| Compound Name | (3aE,5Z,9E)-2-methyl-2,3,7,8-tetrahydrocycloocta[d][1,3]oxazole |
|---|---|
| PubChem CID | 145200827 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (3aE,5Z,9E)-2-methyl-2,3,7,8-tetrahydrocycloocta[d][1,3]oxazole |
| SMILES | CC1NC2=C/C=C\CC/C=C\2O1 |
| InChI | InChI=1S/C10H13NO/c1-8-11-9-6-4-2-3-5-7-10(9)12-8/h2,4,6-8,11H,3,5H2,1H3/b4-2-,9-6+,10-7+ |
| InChIKey | FLSXYKIBFKUUJG-RFAKTJSOSA-N |
| XLogP | 2.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |