C31H32Cl2N2O11 — CID 145201605
[(2R,3S,4R,5R)-3,4,6-triacetyloxy-5-[[1-[(3,4-dichlorophenyl)methyl]-6-methoxyindole-3-carbonyl]amino]oxan-2-yl]methyl acetate (PubChem CID 145201605) has the molecular formula C31H32Cl2N2O11 and a molecular weight of 679.51 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4,6-triacetyloxy-5-[[1-[(3,4-dichlorophenyl)methyl]-6-methoxyindole-3-carbonyl]amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-3,4,6-triacetyloxy-5-[[1-[(3,4-dichlorophenyl)methyl]-6-methoxyindole-3-carbonyl]amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 145201605 |
| Molecular Formula | C31H32Cl2N2O11 |
| Molecular Weight | 679.51 g/mol |
| Exact Mass | 678.14 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4,6-triacetyloxy-5-[[1-[(3,4-dichlorophenyl)methyl]-6-methoxyindole-3-carbonyl]amino]oxan-2-yl]methyl acetate |
| SMILES | COc1ccc2c(C(=O)N[C@H]3C(OC(C)=O)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]3OC(C)=O)cn(Cc3ccc(Cl)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C31H32Cl2N2O11/c1-15(36)42-14-26-28(43-16(2)37)29(44-17(3)38)27(31(46-26)45-18(4)39)34-30(40)22-13-35(12-19-6-9-23(32)24(33)10-19)25-11-20(41-5)7-8-21(22)25/h6-11,13,26-29,31H,12,14H2,1-5H3,(H,34,40)/t26-,27-,28-,29-,31?/m1/s1 |
| InChIKey | VQRIMHLFONDYRM-CTNOIRCQSA-N |
| XLogP | 3.82 |
| TPSA | 157.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|