C9H7ClF2O — CID 145207122
(E)-3-chloro-3-(2,3-difluorophenyl)prop-2-en-1-ol (PubChem CID 145207122) has the molecular formula C9H7ClF2O and a molecular weight of 204.60 g/mol. Its IUPAC name is (E)-3-chloro-3-(2,3-difluorophenyl)prop-2-en-1-ol.
| Compound Name | (E)-3-chloro-3-(2,3-difluorophenyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 145207122 |
| Molecular Formula | C9H7ClF2O |
| Molecular Weight | 204.60 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | (E)-3-chloro-3-(2,3-difluorophenyl)prop-2-en-1-ol |
| SMILES | OC/C=C(/Cl)c1cccc(F)c1F |
| InChI | InChI=1S/C9H7ClF2O/c10-7(4-5-13)6-2-1-3-8(11)9(6)12/h1-4,13H,5H2/b7-4+ |
| InChIKey | DCJRKBJMFIINRX-QPJJXVBHSA-N |
| XLogP | 2.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.60 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |