C51H48N2 — CID 145212458
3-[(1Z,3E)-1-(1,2-dihydrocarbazol-9-yl)hexa-1,3,5-trien-3-yl]-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-9-(4-phenylphenyl)-1,2-dihydrocarbazole;ethane (PubChem CID 145212458) has the molecular formula C51H48N2 and a molecular weight of 688.96 g/mol. Its IUPAC name is 3-[(1Z,3E)-1-(1,2-dihydrocarbazol-9-yl)hexa-1,3,5-trien-3-yl]-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-9-(4-phenylphenyl)-1,2-dihydrocarbazole;ethane.
| Compound Name | 3-[(1Z,3E)-1-(1,2-dihydrocarbazol-9-yl)hexa-1,3,5-trien-3-yl]-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-9-(4-phenylphenyl)-1,2-dihydrocarbazole;ethane |
|---|---|
| PubChem CID | 145212458 |
| Molecular Formula | C51H48N2 |
| Molecular Weight | 688.96 g/mol |
| Exact Mass | 688.38 |
| IUPAC Name | 3-[(1Z,3E)-1-(1,2-dihydrocarbazol-9-yl)hexa-1,3,5-trien-3-yl]-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-9-(4-phenylphenyl)-1,2-dihydrocarbazole;ethane |
| SMILES | C=C/C=C(\C=C/n1c2c(c3ccccc31)C=CCC2)C1=Cc2c(n(-c3ccc(-c4ccccc4)cc3)c3ccc(/C(C=C)=C/C=C\C)cc23)CC1.CC |
| InChI | InChI=1S/C49H42N2.C2H6/c1-4-7-16-35(6-3)39-25-29-48-44(33-39)45-34-40(26-30-49(45)51(48)41-27-23-38(24-28-41)37-17-9-8-10-18-37)36(15-5-2)31-32-50-46-21-13-11-19-42(46)43-20-12-14-22-47(43)50;1-2/h4-13,15-21,23-25,27-29,31-34H,2-3,14,22,26,30H2,1H3;1-2H3/b7-4-,32-31-,35-16+,36-15+; |
| InChIKey | DRUXJEPYZGPGIJ-RWFAXATMSA-N |
| XLogP | 14.00 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.96 |
| LogP ≤ 5 | 14.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|