C63H47N5 — CID 167403592
3-(1,2-dihydrocarbazol-9-yl)-9-[2,6-diphenyl-4-[2-phenyl-4-[(1E,3E)-4-phenylhexa-1,3,5-trienyl]-1,2-dihydro-1,3,5-triazin-6-yl]phenyl]carbazole (PubChem CID 167403592) has the molecular formula C63H47N5 and a molecular weight of 874.10 g/mol. Its IUPAC name is 3-(1,2-dihydrocarbazol-9-yl)-9-[2,6-diphenyl-4-[2-phenyl-4-[(1E,3E)-4-phenylhexa-1,3,5-trienyl]-1,2-dihydro-1,3,5-triazin-6-yl]phenyl]carbazole.
| Compound Name | 3-(1,2-dihydrocarbazol-9-yl)-9-[2,6-diphenyl-4-[2-phenyl-4-[(1E,3E)-4-phenylhexa-1,3,5-trienyl]-1,2-dihydro-1,3,5-triazin-6-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 167403592 |
| Molecular Formula | C63H47N5 |
| Molecular Weight | 874.10 g/mol |
| Exact Mass | 873.38 |
| IUPAC Name | 3-(1,2-dihydrocarbazol-9-yl)-9-[2,6-diphenyl-4-[2-phenyl-4-[(1E,3E)-4-phenylhexa-1,3,5-trienyl]-1,2-dihydro-1,3,5-triazin-6-yl]phenyl]carbazole |
| SMILES | C=C/C(=C\C=C\C1=NC(c2ccccc2)NC(c2cc(-c3ccccc3)c(-n3c4ccccc4c4cc(-n5c6c(c7ccccc75)C=CCC6)ccc43)c(-c3ccccc3)c2)=N1)c1ccccc1 |
| InChI | InChI=1S/C63H47N5/c1-2-43(44-22-7-3-8-23-44)30-21-37-60-64-62(47-28-13-6-14-29-47)66-63(65-60)48-40-53(45-24-9-4-10-25-45)61(54(41-48)46-26-11-5-12-27-46)68-58-36-20-17-33-52(58)55-42-49(38-39-59(55)68)67-56-34-18-15-31-50(56)51-32-16-19-35-57(51)67/h2-18,20-34,36-42,62H,1,19,35H2,(H,64,65,66)/b37-21+,43-30+ |
| InChIKey | BDNKLMQFFBCEJF-PTPBHAHOSA-N |
| XLogP | 15.29 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.10 |
| LogP ≤ 5 | 15.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|