C30H38 — CID 145212487
(9Z,11Z)-8,13-dimethyl-11-[(2Z,4Z)-3-methylhexa-2,4-dienyl]tricyclo[12.5.0.02,7]nonadeca-1(14),2,4,6,9,11,15,17-octaene;ethane (PubChem CID 145212487) has the molecular formula C30H38 and a molecular weight of 398.63 g/mol. Its IUPAC name is (9Z,11Z)-8,13-dimethyl-11-[(2Z,4Z)-3-methylhexa-2,4-dienyl]tricyclo[12.5.0.02,7]nonadeca-1(14),2,4,6,9,11,15,17-octaene;ethane.
| Compound Name | (9Z,11Z)-8,13-dimethyl-11-[(2Z,4Z)-3-methylhexa-2,4-dienyl]tricyclo[12.5.0.02,7]nonadeca-1(14),2,4,6,9,11,15,17-octaene;ethane |
|---|---|
| PubChem CID | 145212487 |
| Molecular Formula | C30H38 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | (9Z,11Z)-8,13-dimethyl-11-[(2Z,4Z)-3-methylhexa-2,4-dienyl]tricyclo[12.5.0.02,7]nonadeca-1(14),2,4,6,9,11,15,17-octaene;ethane |
| SMILES | C/C=C\C(C)=C/CC1=C/C(C)C2=C(CC=CC=C2)c2ccccc2C(C)/C=C\1.CC |
| InChI | InChI=1S/C28H32.C2H6/c1-5-11-21(2)16-18-24-19-17-22(3)25-13-9-10-15-27(25)28-14-8-6-7-12-26(28)23(4)20-24;1-2/h5-13,15-17,19-20,22-23H,14,18H2,1-4H3;1-2H3/b11-5-,19-17-,21-16-,24-20-; |
| InChIKey | DUTOGURITLXHBQ-OODWOUDESA-N |
| XLogP | 9.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|