C16H23N3S — CID 143566331
2-[[(5Z,7Z)-9-methyl-4,9-dihydro-1H-1,3-diazonin-2-yl]sulfanyl]-N-[(1Z,3E)-2-methylpenta-1,3-dienyl]ethanimine (PubChem CID 143566331) has the molecular formula C16H23N3S and a molecular weight of 289.45 g/mol. Its IUPAC name is 2-[[(5Z,7Z)-9-methyl-4,9-dihydro-1H-1,3-diazonin-2-yl]sulfanyl]-N-[(1Z,3E)-2-methylpenta-1,3-dienyl]ethanimine.
| Compound Name | 2-[[(5Z,7Z)-9-methyl-4,9-dihydro-1H-1,3-diazonin-2-yl]sulfanyl]-N-[(1Z,3E)-2-methylpenta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 143566331 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 2-[[(5Z,7Z)-9-methyl-4,9-dihydro-1H-1,3-diazonin-2-yl]sulfanyl]-N-[(1Z,3E)-2-methylpenta-1,3-dienyl]ethanimine |
| SMILES | C/C=C/C(C)=C\N=C\CS/C1=N/C/C=C\C=C/C(C)N1 |
| InChI | InChI=1S/C16H23N3S/c1-4-8-14(2)13-17-11-12-20-16-18-10-7-5-6-9-15(3)19-16/h4-9,11,13,15H,10,12H2,1-3H3,(H,18,19)/b7-5-,8-4+,9-6-,14-13-,17-11+ |
| InChIKey | GXXQZACFVZDVPZ-WPPKYYNASA-N |
| XLogP | 3.73 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|