C12H19N — CID 142890007
4-methyl-6-[(1Z,3Z)-2-methylpenta-1,3-dienyl]-1,2,3,4-tetrahydropyridine (PubChem CID 142890007) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 4-methyl-6-[(1Z,3Z)-2-methylpenta-1,3-dienyl]-1,2,3,4-tetrahydropyridine.
| Compound Name | 4-methyl-6-[(1Z,3Z)-2-methylpenta-1,3-dienyl]-1,2,3,4-tetrahydropyridine |
|---|---|
| PubChem CID | 142890007 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 4-methyl-6-[(1Z,3Z)-2-methylpenta-1,3-dienyl]-1,2,3,4-tetrahydropyridine |
| SMILES | C/C=C\C(C)=C/C1=CC(C)CCN1 |
| InChI | InChI=1S/C12H19N/c1-4-5-10(2)8-12-9-11(3)6-7-13-12/h4-5,8-9,11,13H,6-7H2,1-3H3/b5-4-,10-8- |
| InChIKey | VYLLPJSDADHTNE-BXPWTJTASA-N |
| XLogP | 3.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|