C8H14NO+ — CID 59886712
(Z)-ethylidene-hydroxy-[(1Z,3E)-2-methylpenta-1,3-dienyl]azanium (PubChem CID 59886712) has the molecular formula C8H14NO+ and a molecular weight of 140.21 g/mol. Its IUPAC name is (Z)-ethylidene-hydroxy-[(1Z,3E)-2-methylpenta-1,3-dienyl]azanium.
| Compound Name | (Z)-ethylidene-hydroxy-[(1Z,3E)-2-methylpenta-1,3-dienyl]azanium |
|---|---|
| PubChem CID | 59886712 |
| Molecular Formula | C8H14NO+ |
| Molecular Weight | 140.21 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | (Z)-ethylidene-hydroxy-[(1Z,3E)-2-methylpenta-1,3-dienyl]azanium |
| SMILES | C/C=[N+](O)/C=C(C)\C=C\C |
| InChI | InChI=1S/C8H14NO/c1-4-6-8(3)7-9(10)5-2/h4-7,10H,1-3H3/q+1/b6-4+,8-7-,9-5- |
| InChIKey | RDOZVNOJOOTNCT-MRXOWIMESA-N |
| XLogP | 1.96 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.21 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|