C22H32FNO7 — CID 145213279
2-fluoroethyl hydrogen carbonate;2-[[1-[3-hydroxy-3-(methylamino)propyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid (PubChem CID 145213279) has the molecular formula C22H32FNO7 and a molecular weight of 441.50 g/mol. Its IUPAC name is 2-fluoroethyl hydrogen carbonate;2-[[1-[3-hydroxy-3-(methylamino)propyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid.
| Compound Name | 2-fluoroethyl hydrogen carbonate;2-[[1-[3-hydroxy-3-(methylamino)propyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 145213279 |
| Molecular Formula | C22H32FNO7 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 2-fluoroethyl hydrogen carbonate;2-[[1-[3-hydroxy-3-(methylamino)propyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid |
| SMILES | CNC(O)CCC1CCC2Cc3c(cccc3OCC(=O)O)CC12.O=C(O)OCCF |
| InChI | InChI=1S/C19H27NO4.C3H5FO3/c1-20-18(21)8-7-12-5-6-14-10-16-13(9-15(12)14)3-2-4-17(16)24-11-19(22)23;4-1-2-7-3(5)6/h2-4,12,14-15,18,20-21H,5-11H2,1H3,(H,22,23);1-2H2,(H,5,6) |
| InChIKey | QOFZKUKQYSNTLX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|