C23H20N6O4S — CID 145216856
methyl 3-[[[3-amino-6-(2-carbamoylphenyl)sulfanylpyrazine-2-carbonyl]amino]methyl]-1H-indole-2-carboxylate (PubChem CID 145216856) has the molecular formula C23H20N6O4S and a molecular weight of 476.52 g/mol. Its IUPAC name is methyl 3-[[[3-amino-6-(2-carbamoylphenyl)sulfanylpyrazine-2-carbonyl]amino]methyl]-1H-indole-2-carboxylate.
| Compound Name | methyl 3-[[[3-amino-6-(2-carbamoylphenyl)sulfanylpyrazine-2-carbonyl]amino]methyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 145216856 |
| Molecular Formula | C23H20N6O4S |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | methyl 3-[[[3-amino-6-(2-carbamoylphenyl)sulfanylpyrazine-2-carbonyl]amino]methyl]-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2ccccc2c1CNC(=O)c1nc(Sc2ccccc2C(N)=O)cnc1N |
| InChI | InChI=1S/C23H20N6O4S/c1-33-23(32)18-14(12-6-2-4-8-15(12)28-18)10-27-22(31)19-20(24)26-11-17(29-19)34-16-9-5-3-7-13(16)21(25)30/h2-9,11,28H,10H2,1H3,(H2,24,26)(H2,25,30)(H,27,31) |
| InChIKey | UYSAWPZDCUTQAL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 166.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|