C15H16FNO2 — CID 145222476
methyl (Z,2E)-2-ethylidene-5-(3-fluorophenyl)-4-(methylideneamino)pent-3-enoate (PubChem CID 145222476) has the molecular formula C15H16FNO2 and a molecular weight of 261.30 g/mol. Its IUPAC name is methyl (Z,2E)-2-ethylidene-5-(3-fluorophenyl)-4-(methylideneamino)pent-3-enoate.
| Compound Name | methyl (Z,2E)-2-ethylidene-5-(3-fluorophenyl)-4-(methylideneamino)pent-3-enoate |
|---|---|
| PubChem CID | 145222476 |
| Molecular Formula | C15H16FNO2 |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | methyl (Z,2E)-2-ethylidene-5-(3-fluorophenyl)-4-(methylideneamino)pent-3-enoate |
| SMILES | C=N/C(=C\C(=C/C)C(=O)OC)Cc1cccc(F)c1 |
| InChI | InChI=1S/C15H16FNO2/c1-4-12(15(18)19-3)10-14(17-2)9-11-6-5-7-13(16)8-11/h4-8,10H,2,9H2,1,3H3/b12-4+,14-10- |
| InChIKey | BRWLPZPFSBKFAP-RENUUGLQSA-N |
| XLogP | 3.07 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|