C28H36FNO3 — CID 145355656
methyl (2E,4Z)-4-[1-[[(1Z,3Z)-1-ethoxypenta-1,3-dien-3-yl]-[2-(4-fluorophenyl)ethyl]amino]ethenyl]-2-[(Z)-prop-1-enyl]hepta-2,4-dienoate (PubChem CID 145355656) has the molecular formula C28H36FNO3 and a molecular weight of 453.60 g/mol. Its IUPAC name is methyl (2E,4Z)-4-[1-[[(1Z,3Z)-1-ethoxypenta-1,3-dien-3-yl]-[2-(4-fluorophenyl)ethyl]amino]ethenyl]-2-[(Z)-prop-1-enyl]hepta-2,4-dienoate.
| Compound Name | methyl (2E,4Z)-4-[1-[[(1Z,3Z)-1-ethoxypenta-1,3-dien-3-yl]-[2-(4-fluorophenyl)ethyl]amino]ethenyl]-2-[(Z)-prop-1-enyl]hepta-2,4-dienoate |
|---|---|
| PubChem CID | 145355656 |
| Molecular Formula | C28H36FNO3 |
| Molecular Weight | 453.60 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | methyl (2E,4Z)-4-[1-[[(1Z,3Z)-1-ethoxypenta-1,3-dien-3-yl]-[2-(4-fluorophenyl)ethyl]amino]ethenyl]-2-[(Z)-prop-1-enyl]hepta-2,4-dienoate |
| SMILES | C=C(C(=C\CC)/C=C(\C=C/C)C(=O)OC)N(CCc1ccc(F)cc1)C(/C=C\OCC)=C\C |
| InChI | InChI=1S/C28H36FNO3/c1-7-11-24(21-25(12-8-2)28(31)32-6)22(5)30(27(9-3)18-20-33-10-4)19-17-23-13-15-26(29)16-14-23/h8-9,11-16,18,20-21H,5,7,10,17,19H2,1-4,6H3/b12-8-,20-18-,24-11-,25-21+,27-9- |
| InChIKey | OQPAIIFKJUTYKD-BPHLEHKZSA-N |
| XLogP | 6.65 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.60 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|