C25H31BrFNO2 — CID 145355756
methyl (2E,4Z)-4-[1-[[(E)-1-bromoprop-1-enyl]-[2-(4-fluorophenyl)ethyl]amino]ethenyl]-2-[(Z)-prop-1-enyl]octa-2,4-dienoate (PubChem CID 145355756) has the molecular formula C25H31BrFNO2 and a molecular weight of 476.43 g/mol. Its IUPAC name is methyl (2E,4Z)-4-[1-[[(E)-1-bromoprop-1-enyl]-[2-(4-fluorophenyl)ethyl]amino]ethenyl]-2-[(Z)-prop-1-enyl]octa-2,4-dienoate.
| Compound Name | methyl (2E,4Z)-4-[1-[[(E)-1-bromoprop-1-enyl]-[2-(4-fluorophenyl)ethyl]amino]ethenyl]-2-[(Z)-prop-1-enyl]octa-2,4-dienoate |
|---|---|
| PubChem CID | 145355756 |
| Molecular Formula | C25H31BrFNO2 |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | methyl (2E,4Z)-4-[1-[[(E)-1-bromoprop-1-enyl]-[2-(4-fluorophenyl)ethyl]amino]ethenyl]-2-[(Z)-prop-1-enyl]octa-2,4-dienoate |
| SMILES | C=C(C(=C\CCC)/C=C(\C=C/C)C(=O)OC)N(CCc1ccc(F)cc1)/C(Br)=C\C |
| InChI | InChI=1S/C25H31BrFNO2/c1-6-9-11-21(18-22(10-7-2)25(29)30-5)19(4)28(24(26)8-3)17-16-20-12-14-23(27)15-13-20/h7-8,10-15,18H,4,6,9,16-17H2,1-3,5H3/b10-7-,21-11-,22-18+,24-8- |
| InChIKey | QZKQBZFYXDGOCS-DCAUEWMQSA-N |
| XLogP | 6.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|