C20H30N2O4S — CID 145222649
tert-butyl 4-[[5-(cyanomethyl)-4-formylthiophen-2-yl]methyl]piperidine-1-carboxylate;methoxymethane (PubChem CID 145222649) has the molecular formula C20H30N2O4S and a molecular weight of 394.54 g/mol. Its IUPAC name is tert-butyl 4-[[5-(cyanomethyl)-4-formylthiophen-2-yl]methyl]piperidine-1-carboxylate;methoxymethane.
| Compound Name | tert-butyl 4-[[5-(cyanomethyl)-4-formylthiophen-2-yl]methyl]piperidine-1-carboxylate;methoxymethane |
|---|---|
| PubChem CID | 145222649 |
| Molecular Formula | C20H30N2O4S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | tert-butyl 4-[[5-(cyanomethyl)-4-formylthiophen-2-yl]methyl]piperidine-1-carboxylate;methoxymethane |
| SMILES | CC(C)(C)OC(=O)N1CCC(Cc2cc(C=O)c(CC#N)s2)CC1.COC |
| InChI | InChI=1S/C18H24N2O3S.C2H6O/c1-18(2,3)23-17(22)20-8-5-13(6-9-20)10-15-11-14(12-21)16(24-15)4-7-19;1-3-2/h11-13H,4-6,8-10H2,1-3H3;1-2H3 |
| InChIKey | XRQLGKSQQXNJBQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|