C16H24N2O5 — CID 57272527
tert-butyl 4-[2,5-dihydroxy-1-(2-oxoethyl)pyrrol-3-yl]piperidine-1-carboxylate (PubChem CID 57272527) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is tert-butyl 4-[2,5-dihydroxy-1-(2-oxoethyl)pyrrol-3-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2,5-dihydroxy-1-(2-oxoethyl)pyrrol-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 57272527 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | tert-butyl 4-[2,5-dihydroxy-1-(2-oxoethyl)pyrrol-3-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc(O)n(CC=O)c2O)CC1 |
| InChI | InChI=1S/C16H24N2O5/c1-16(2,3)23-15(22)17-6-4-11(5-7-17)12-10-13(20)18(8-9-19)14(12)21/h9-11,20-21H,4-8H2,1-3H3 |
| InChIKey | ANCSBLMEQXVVPY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|