C11H15ClO2 — CID 145226123
3-(5-chloro-2,4-dimethylphenoxy)propan-1-ol (PubChem CID 145226123) has the molecular formula C11H15ClO2 and a molecular weight of 214.69 g/mol. Its IUPAC name is 3-(5-chloro-2,4-dimethylphenoxy)propan-1-ol.
| Compound Name | 3-(5-chloro-2,4-dimethylphenoxy)propan-1-ol |
|---|---|
| PubChem CID | 145226123 |
| Molecular Formula | C11H15ClO2 |
| Molecular Weight | 214.69 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 3-(5-chloro-2,4-dimethylphenoxy)propan-1-ol |
| SMILES | Cc1cc(C)c(OCCCO)cc1Cl |
| InChI | InChI=1S/C11H15ClO2/c1-8-6-9(2)11(7-10(8)12)14-5-3-4-13/h6-7,13H,3-5H2,1-2H3 |
| InChIKey | XUCNLJPPGGBNKU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.69 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|