C22H30FN3O3S — CID 145227594
3-(cyclopropylmethoxy)-4-fluoro-N-[2-methyl-6-[(2-oxo-1H-pyridin-3-yl)amino]hexan-2-yl]benzenesulfinamide (PubChem CID 145227594) has the molecular formula C22H30FN3O3S and a molecular weight of 435.57 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-4-fluoro-N-[2-methyl-6-[(2-oxo-1H-pyridin-3-yl)amino]hexan-2-yl]benzenesulfinamide.
| Compound Name | 3-(cyclopropylmethoxy)-4-fluoro-N-[2-methyl-6-[(2-oxo-1H-pyridin-3-yl)amino]hexan-2-yl]benzenesulfinamide |
|---|---|
| PubChem CID | 145227594 |
| Molecular Formula | C22H30FN3O3S |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 3-(cyclopropylmethoxy)-4-fluoro-N-[2-methyl-6-[(2-oxo-1H-pyridin-3-yl)amino]hexan-2-yl]benzenesulfinamide |
| SMILES | CC(C)(CCCCNc1ccc[nH]c1=O)NS(=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C22H30FN3O3S/c1-22(2,11-3-4-12-24-19-6-5-13-25-21(19)27)26-30(28)17-9-10-18(23)20(14-17)29-15-16-7-8-16/h5-6,9-10,13-14,16,24,26H,3-4,7-8,11-12,15H2,1-2H3,(H,25,27) |
| InChIKey | YWJDUYVLKOFGIC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|