C25H34FN3O4S — CID 161043823
3-[3-[2-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]pyrrolidin-1-yl]sulfonylpropylamino]-6-methyl-1H-pyridin-2-one (PubChem CID 161043823) has the molecular formula C25H34FN3O4S and a molecular weight of 491.63 g/mol. Its IUPAC name is 3-[3-[2-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]pyrrolidin-1-yl]sulfonylpropylamino]-6-methyl-1H-pyridin-2-one.
| Compound Name | 3-[3-[2-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]pyrrolidin-1-yl]sulfonylpropylamino]-6-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 161043823 |
| Molecular Formula | C25H34FN3O4S |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | 3-[3-[2-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]pyrrolidin-1-yl]sulfonylpropylamino]-6-methyl-1H-pyridin-2-one |
| SMILES | Cc1ccc(NCCCS(=O)(=O)N2CCCC2C(C)c2ccc(F)c(OCC3CC3)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C25H34FN3O4S/c1-17-6-11-22(25(30)28-17)27-12-4-14-34(31,32)29-13-3-5-23(29)18(2)20-9-10-21(26)24(15-20)33-16-19-7-8-19/h6,9-11,15,18-19,23,27H,3-5,7-8,12-14,16H2,1-2H3,(H,28,30) |
| InChIKey | ZOGURMJFGBTBRG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|