C35H49N5O13 — CID 145228244
2-[5-[5-[[2-[1-[1-(ethylamino)ethenoxy-formylamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-2-formylphenoxy]acetic acid;2-(methylamino)butanedioic acid (PubChem CID 145228244) has the molecular formula C35H49N5O13 and a molecular weight of 747.80 g/mol. Its IUPAC name is 2-[5-[5-[[2-[1-[1-(ethylamino)ethenoxy-formylamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-2-formylphenoxy]acetic acid;2-(methylamino)butanedioic acid.
| Compound Name | 2-[5-[5-[[2-[1-[1-(ethylamino)ethenoxy-formylamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-2-formylphenoxy]acetic acid;2-(methylamino)butanedioic acid |
|---|---|
| PubChem CID | 145228244 |
| Molecular Formula | C35H49N5O13 |
| Molecular Weight | 747.80 g/mol |
| Exact Mass | 747.33 |
| IUPAC Name | 2-[5-[5-[[2-[1-[1-(ethylamino)ethenoxy-formylamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-2-formylphenoxy]acetic acid;2-(methylamino)butanedioic acid |
| SMILES | C=C(NCC)ON(C=O)C(CC)C(CCCCC)C(=O)NCNC(=O)c1ccc(-c2ccc(C=O)c(OCC(=O)O)c2)o1.CNC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C30H40N4O9.C5H9NO4/c1-5-8-9-10-23(24(6-2)34(19-36)43-20(4)31-7-3)29(39)32-18-33-30(40)26-14-13-25(42-26)21-11-12-22(16-35)27(15-21)41-17-28(37)38;1-6-3(5(9)10)2-4(7)8/h11-16,19,23-24,31H,4-10,17-18H2,1-3H3,(H,32,39)(H,33,40)(H,37,38);3,6H,2H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | NJJUMNVHQHZYLB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 263.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.80 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|