C14H23 — CID 145231449
CID 145231449 (PubChem CID 145231449) has the molecular formula C14H23 and a molecular weight of 191.34 g/mol.
| Compound Name | CID 145231449 |
|---|---|
| PubChem CID | 145231449 |
| Molecular Formula | C14H23 |
| Molecular Weight | 191.34 g/mol |
| Exact Mass | 191.18 |
| IUPAC Name | — |
| SMILES | C#C[C@@]1(C)CCC([CH2])(C(C)C)C[C@@H]1C |
| InChI | InChI=1S/C14H23/c1-7-13(5)8-9-14(6,11(2)3)10-12(13)4/h1,11-12H,6,8-10H2,2-5H3/t12-,13-,14?/m0/s1 |
| InChIKey | YVWNIIGEQYYEQS-RFHHWMCGSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|