C19H15ClF6N2OS — CID 145232901
1-chloro-4-(trifluoromethyl)benzene;1-[2-(trifluoromethyl)-4-pyridinyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-one (PubChem CID 145232901) has the molecular formula C19H15ClF6N2OS and a molecular weight of 468.85 g/mol. Its IUPAC name is 1-chloro-4-(trifluoromethyl)benzene;1-[2-(trifluoromethyl)-4-pyridinyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-one.
| Compound Name | 1-chloro-4-(trifluoromethyl)benzene;1-[2-(trifluoromethyl)-4-pyridinyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-one |
|---|---|
| PubChem CID | 145232901 |
| Molecular Formula | C19H15ClF6N2OS |
| Molecular Weight | 468.85 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | 1-chloro-4-(trifluoromethyl)benzene;1-[2-(trifluoromethyl)-4-pyridinyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-one |
| SMILES | FC(F)(F)c1ccc(Cl)cc1.O=C1SC(c2ccnc(C(F)(F)F)c2)C2CCCN12 |
| InChI | InChI=1S/C12H11F3N2OS.C7H4ClF3/c13-12(14,15)9-6-7(3-4-16-9)10-8-2-1-5-17(8)11(18)19-10;8-6-3-1-5(2-4-6)7(9,10)11/h3-4,6,8,10H,1-2,5H2;1-4H |
| InChIKey | PUFNPJKFOIQIOE-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.85 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|