C23H24N2O5S — CID 145232968
N,2-dihydroxy-4-[2-methylpropyl-(4-phenoxyphenyl)sulfinylamino]benzamide (PubChem CID 145232968) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is N,2-dihydroxy-4-[2-methylpropyl-(4-phenoxyphenyl)sulfinylamino]benzamide.
| Compound Name | N,2-dihydroxy-4-[2-methylpropyl-(4-phenoxyphenyl)sulfinylamino]benzamide |
|---|---|
| PubChem CID | 145232968 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | N,2-dihydroxy-4-[2-methylpropyl-(4-phenoxyphenyl)sulfinylamino]benzamide |
| SMILES | CC(C)CN(c1ccc(C(=O)NO)c(O)c1)S(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N2O5S/c1-16(2)15-25(17-8-13-21(22(26)14-17)23(27)24-28)31(29)20-11-9-19(10-12-20)30-18-6-4-3-5-7-18/h3-14,16,26,28H,15H2,1-2H3,(H,24,27) |
| InChIKey | DOUPNJGGVSBLTK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|