C24H28FN7O3 — CID 145233993
2-[4-[2-fluoro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-5-methyl-1,4-diazepan-1-yl]-6-methoxy-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 145233993) has the molecular formula C24H28FN7O3 and a molecular weight of 481.53 g/mol. Its IUPAC name is 2-[4-[2-fluoro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-5-methyl-1,4-diazepan-1-yl]-6-methoxy-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 2-[4-[2-fluoro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-5-methyl-1,4-diazepan-1-yl]-6-methoxy-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 145233993 |
| Molecular Formula | C24H28FN7O3 |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | 2-[4-[2-fluoro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-5-methyl-1,4-diazepan-1-yl]-6-methoxy-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | [H]/N=C/C=N\Nc1cccc(F)c1C(=O)N1CCN(C2NC(=O)c3cc(OC)ccc3N2)CCC1C |
| InChI | InChI=1S/C24H28FN7O3/c1-15-8-11-31(24-28-19-7-6-16(35-2)14-17(19)22(33)29-24)12-13-32(15)23(34)21-18(25)4-3-5-20(21)30-27-10-9-26/h3-7,9-10,14-15,24,26,28,30H,8,11-13H2,1-2H3,(H,29,33)/b26-9+,27-10- |
| InChIKey | GHKCFOZQICFHPS-ADRRQTRBSA-N |
| XLogP | 2.56 |
| TPSA | 122.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|