C21H23F2N3O — CID 145238839
2,2-difluoroethyl (1Z)-4-[3-(1,3-dihydroisoindol-2-yl)propyl]-N-methylidenebenzenecarbohydrazonate (PubChem CID 145238839) has the molecular formula C21H23F2N3O and a molecular weight of 371.43 g/mol. Its IUPAC name is 2,2-difluoroethyl (1Z)-4-[3-(1,3-dihydroisoindol-2-yl)propyl]-N-methylidenebenzenecarbohydrazonate.
| Compound Name | 2,2-difluoroethyl (1Z)-4-[3-(1,3-dihydroisoindol-2-yl)propyl]-N-methylidenebenzenecarbohydrazonate |
|---|---|
| PubChem CID | 145238839 |
| Molecular Formula | C21H23F2N3O |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 2,2-difluoroethyl (1Z)-4-[3-(1,3-dihydroisoindol-2-yl)propyl]-N-methylidenebenzenecarbohydrazonate |
| SMILES | C=N/N=C(\OCC(F)F)c1ccc(CCCN2Cc3ccccc3C2)cc1 |
| InChI | InChI=1S/C21H23F2N3O/c1-24-25-21(27-15-20(22)23)17-10-8-16(9-11-17)5-4-12-26-13-18-6-2-3-7-19(18)14-26/h2-3,6-11,20H,1,4-5,12-15H2/b25-21- |
| InChIKey | XBVVFOMXOBBBGY-DAFNUICNSA-N |
| XLogP | 4.28 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|