C18H25F2N3O — CID 145239373
2,2-difluoroethyl (1Z)-N-methylidene-4-(4-pyrrolidin-1-ylbutyl)benzenecarbohydrazonate (PubChem CID 145239373) has the molecular formula C18H25F2N3O and a molecular weight of 337.41 g/mol. Its IUPAC name is 2,2-difluoroethyl (1Z)-N-methylidene-4-(4-pyrrolidin-1-ylbutyl)benzenecarbohydrazonate.
| Compound Name | 2,2-difluoroethyl (1Z)-N-methylidene-4-(4-pyrrolidin-1-ylbutyl)benzenecarbohydrazonate |
|---|---|
| PubChem CID | 145239373 |
| Molecular Formula | C18H25F2N3O |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 2,2-difluoroethyl (1Z)-N-methylidene-4-(4-pyrrolidin-1-ylbutyl)benzenecarbohydrazonate |
| SMILES | C=N/N=C(\OCC(F)F)c1ccc(CCCCN2CCCC2)cc1 |
| InChI | InChI=1S/C18H25F2N3O/c1-21-22-18(24-14-17(19)20)16-9-7-15(8-10-16)6-2-3-11-23-12-4-5-13-23/h7-10,17H,1-6,11-14H2/b22-18- |
| InChIKey | WYQOICXOKCSGOF-PYCFMQQDSA-N |
| XLogP | 3.75 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|