C27H27BO3 — CID 145243219
2-[5-ethenyl-6-[(Z)-prop-1-enyl]naphtho[2,1-b][1]benzofuran-10-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 145243219) has the molecular formula C27H27BO3 and a molecular weight of 410.32 g/mol. Its IUPAC name is 2-[5-ethenyl-6-[(Z)-prop-1-enyl]naphtho[2,1-b][1]benzofuran-10-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[5-ethenyl-6-[(Z)-prop-1-enyl]naphtho[2,1-b][1]benzofuran-10-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 145243219 |
| Molecular Formula | C27H27BO3 |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 2-[5-ethenyl-6-[(Z)-prop-1-enyl]naphtho[2,1-b][1]benzofuran-10-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=Cc1c(/C=C\C)c2oc3ccc(B4OC(C)(C)C(C)(C)O4)cc3c2c2ccccc12 |
| InChI | InChI=1S/C27H27BO3/c1-7-11-21-18(8-2)19-12-9-10-13-20(19)24-22-16-17(14-15-23(22)29-25(21)24)28-30-26(3,4)27(5,6)31-28/h7-16H,2H2,1,3-6H3/b11-7- |
| InChIKey | RXUAZLQQAWPOIV-XFFZJAGNSA-N |
| XLogP | 6.71 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|