C23H19ClFN3 — CID 145244523
6-[4-(aminomethyl)phenyl]-3-chloro-N-[(2-fluorophenyl)methyl]quinolin-4-amine (PubChem CID 145244523) has the molecular formula C23H19ClFN3 and a molecular weight of 391.88 g/mol. Its IUPAC name is 6-[4-(aminomethyl)phenyl]-3-chloro-N-[(2-fluorophenyl)methyl]quinolin-4-amine.
| Compound Name | 6-[4-(aminomethyl)phenyl]-3-chloro-N-[(2-fluorophenyl)methyl]quinolin-4-amine |
|---|---|
| PubChem CID | 145244523 |
| Molecular Formula | C23H19ClFN3 |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 6-[4-(aminomethyl)phenyl]-3-chloro-N-[(2-fluorophenyl)methyl]quinolin-4-amine |
| SMILES | NCc1ccc(-c2ccc3ncc(Cl)c(NCc4ccccc4F)c3c2)cc1 |
| InChI | InChI=1S/C23H19ClFN3/c24-20-14-27-22-10-9-17(16-7-5-15(12-26)6-8-16)11-19(22)23(20)28-13-18-3-1-2-4-21(18)25/h1-11,14H,12-13,26H2,(H,27,28) |
| InChIKey | VJRPTNPVAWMGSH-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |