C33H35N5OS — CID 145250623
1-[5-[2-[5-[(2E,4E,6S)-2-(dimethylamino)-6-methylocta-2,4,7-trien-4-yl]-2H-pyrazolo[3,4-b]pyridin-3-yl]-7-methyl-1,8-dihydrocyclohepta[b]pyrrol-4-yl]thiophen-2-yl]ethanone (PubChem CID 145250623) has the molecular formula C33H35N5OS and a molecular weight of 549.74 g/mol. Its IUPAC name is 1-[5-[2-[5-[(2E,4E,6S)-2-(dimethylamino)-6-methylocta-2,4,7-trien-4-yl]-2H-pyrazolo[3,4-b]pyridin-3-yl]-7-methyl-1,8-dihydrocyclohepta[b]pyrrol-4-yl]thiophen-2-yl]ethanone.
| Compound Name | 1-[5-[2-[5-[(2E,4E,6S)-2-(dimethylamino)-6-methylocta-2,4,7-trien-4-yl]-2H-pyrazolo[3,4-b]pyridin-3-yl]-7-methyl-1,8-dihydrocyclohepta[b]pyrrol-4-yl]thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 145250623 |
| Molecular Formula | C33H35N5OS |
| Molecular Weight | 549.74 g/mol |
| Exact Mass | 549.26 |
| IUPAC Name | 1-[5-[2-[5-[(2E,4E,6S)-2-(dimethylamino)-6-methylocta-2,4,7-trien-4-yl]-2H-pyrazolo[3,4-b]pyridin-3-yl]-7-methyl-1,8-dihydrocyclohepta[b]pyrrol-4-yl]thiophen-2-yl]ethanone |
| SMILES | C=C[C@H](C)/C=C(\C=C(/C)N(C)C)c1cnc2n[nH]c(-c3cc4c([nH]3)CC(C)=CC=C4c3ccc(C(C)=O)s3)c2c1 |
| InChI | InChI=1S/C33H35N5OS/c1-8-19(2)13-23(15-21(4)38(6)7)24-16-27-32(36-37-33(27)34-18-24)29-17-26-25(10-9-20(3)14-28(26)35-29)31-12-11-30(40-31)22(5)39/h8-13,15-19,35H,1,14H2,2-7H3,(H,34,36,37)/b21-15+,23-13+/t19-/m0/s1 |
| InChIKey | JFGXMXUDENREBA-BBZOMPKZSA-N |
| XLogP | 7.82 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.74 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|