C15H24N5O13P3 — CID 145255686
[2-[(2R,4R,5R)-5-(4-amino-5-carbamoyl-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-4-methoxyoxolan-2-yl]ethoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 145255686) has the molecular formula C15H24N5O13P3 and a molecular weight of 575.30 g/mol. Its IUPAC name is [2-[(2R,4R,5R)-5-(4-amino-5-carbamoyl-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-4-methoxyoxolan-2-yl]ethoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [2-[(2R,4R,5R)-5-(4-amino-5-carbamoyl-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-4-methoxyoxolan-2-yl]ethoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 145255686 |
| Molecular Formula | C15H24N5O13P3 |
| Molecular Weight | 575.30 g/mol |
| Exact Mass | 575.06 |
| IUPAC Name | [2-[(2R,4R,5R)-5-(4-amino-5-carbamoyl-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-4-methoxyoxolan-2-yl]ethoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CO[C@@H]1C[C@@H](CCOP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1cc(C(N)=O)c2c(N)nc(C)nc21 |
| InChI | InChI=1S/C15H24N5O13P3/c1-7-18-12(16)11-9(13(17)21)6-20(14(11)19-7)15-10(29-2)5-8(31-15)3-4-30-35(25,26)33-36(27,28)32-34(22,23)24/h6,8,10,15H,3-5H2,1-2H3,(H2,17,21)(H,25,26)(H,27,28)(H2,16,18,19)(H2,22,23,24)/t8-,10-,15-/m1/s1 |
| InChIKey | QWTPWYAPPHVREM-FFTROKDMSA-N |
| XLogP | 0.46 |
| TPSA | 278.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|