About methyl triphenoxy silicate
methyl triphenoxy silicate (PubChem CID 145267376) has the molecular formula C19H18O7Si
and a molecular weight of 386.43 g/mol. Its IUPAC name is methyl triphenoxy silicate.
Molecular Properties
| Compound Name | methyl triphenoxy silicate |
| PubChem CID | 145267376 |
| Molecular Formula | C19H18O7Si |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | methyl triphenoxy silicate |
| SMILES | CO[Si](OOc1ccccc1)(OOc1ccccc1)OOc1ccccc1 |
| InChI | InChI=1S/C19H18O7Si/c1-20-27(24-21-17-11-5-2-6-12-17,25-22-18-13-7-3-8-14-18)26-23-19-15-9-4-10-16-19/h2-16H,1H3 |
| InChIKey | ADWYIGLYGUPTLC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze methyl triphenoxy silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl triphenoxy silicate?
The IUPAC name of methyl triphenoxy silicate (CID 145267376) is methyl triphenoxy silicate.
What is the SMILES notation for methyl triphenoxy silicate?
The canonical SMILES for methyl triphenoxy silicate is CO[Si](OOc1ccccc1)(OOc1ccccc1)OOc1ccccc1.
What is the InChIKey of methyl triphenoxy silicate?
The InChIKey is ADWYIGLYGUPTLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18O7Si/c1-20-27(24-21-17-11-5-2-6-12-17,25-22-18-13-7-3-8-14-18)26-23-19-15-9-4-10-16-19/h2-16H,1H3.
What are the key properties of methyl triphenoxy silicate?
methyl triphenoxy silicate has a molecular weight of 386.43 g/mol, XLogP of 4.10, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl triphenoxy silicate is sourced from PubChem (CID 145267376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).