About [(3S)-3-[(4-chlorophenyl)methyl]morpholin-4-yl] thiohypoiodite;formic acid
[(3S)-3-[(4-chlorophenyl)methyl]morpholin-4-yl] thiohypoiodite;formic acid (PubChem CID 145267923) has the molecular formula C12H15ClINO3S
and a molecular weight of 415.68 g/mol. Its IUPAC name is [(3S)-3-[(4-chlorophenyl)methyl]morpholin-4-yl] thiohypoiodite;formic acid.
Molecular Properties
| Compound Name | [(3S)-3-[(4-chlorophenyl)methyl]morpholin-4-yl] thiohypoiodite;formic acid |
| PubChem CID | 145267923 |
| Molecular Formula | C12H15ClINO3S |
| Molecular Weight | 415.68 g/mol |
| Exact Mass | 414.95 |
| IUPAC Name | [(3S)-3-[(4-chlorophenyl)methyl]morpholin-4-yl] thiohypoiodite;formic acid |
| SMILES | Clc1ccc(C[C@H]2COCCN2SI)cc1.O=CO |
| InChI | InChI=1S/C11H13ClINOS.CH2O2/c12-10-3-1-9(2-4-10)7-11-8-15-6-5-14(11)16-13;2-1-3/h1-4,11H,5-8H2;1H,(H,2,3)/t11-;/m0./s1 |
| InChIKey | KAZQMEFXCRNFIP-MERQFXBCSA-N |
| XLogP | 3.28 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.68 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-3-[(4-chlorophenyl)methyl]morpholin-4-yl] thiohypoiodite;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-3-[(4-chlorophenyl)methyl]morpholin-4-yl] thiohypoiodite;formic acid?
The IUPAC name of [(3S)-3-[(4-chlorophenyl)methyl]morpholin-4-yl] thiohypoiodite;formic acid (CID 145267923) is [(3S)-3-[(4-chlorophenyl)methyl]morpholin-4-yl] thiohypoiodite;formic acid.
What is the SMILES notation for [(3S)-3-[(4-chlorophenyl)methyl]morpholin-4-yl] thiohypoiodite;formic acid?
The canonical SMILES for [(3S)-3-[(4-chlorophenyl)methyl]morpholin-4-yl] thiohypoiodite;formic acid is Clc1ccc(C[C@H]2COCCN2SI)cc1.O=CO.
What is the InChIKey of [(3S)-3-[(4-chlorophenyl)methyl]morpholin-4-yl] thiohypoiodite;formic acid?
The InChIKey is KAZQMEFXCRNFIP-MERQFXBCSA-N. The full InChI is InChI=1S/C11H13ClINOS.CH2O2/c12-10-3-1-9(2-4-10)7-11-8-15-6-5-14(11)16-13;2-1-3/h1-4,11H,5-8H2;1H,(H,2,3)/t11-;/m0./s1.
What are the key properties of [(3S)-3-[(4-chlorophenyl)methyl]morpholin-4-yl] thiohypoiodite;formic acid?
[(3S)-3-[(4-chlorophenyl)methyl]morpholin-4-yl] thiohypoiodite;formic acid has a molecular weight of 415.68 g/mol, XLogP of 3.28, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-3-[(4-chlorophenyl)methyl]morpholin-4-yl] thiohypoiodite;formic acid is sourced from PubChem (CID 145267923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).