C9H11FN2O — CID 145275654
1-(1-fluorocyclohexa-2,4-dien-1-yl)imidazolidin-2-one (PubChem CID 145275654) has the molecular formula C9H11FN2O and a molecular weight of 182.20 g/mol. Its IUPAC name is 1-(1-fluorocyclohexa-2,4-dien-1-yl)imidazolidin-2-one.
| Compound Name | 1-(1-fluorocyclohexa-2,4-dien-1-yl)imidazolidin-2-one |
|---|---|
| PubChem CID | 145275654 |
| Molecular Formula | C9H11FN2O |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 1-(1-fluorocyclohexa-2,4-dien-1-yl)imidazolidin-2-one |
| SMILES | O=C1NCCN1C1(F)C=CC=CC1 |
| InChI | InChI=1S/C9H11FN2O/c10-9(4-2-1-3-5-9)12-7-6-11-8(12)13/h1-4H,5-7H2,(H,11,13) |
| InChIKey | NFFKAXGOMQEJGE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|