C23H24 — CID 145276200
(1E)-1-ethylidene-3-methyl-2-methylidene-4-phenyl-6-propan-2-ylnaphthalene (PubChem CID 145276200) has the molecular formula C23H24 and a molecular weight of 300.44 g/mol. Its IUPAC name is (1E)-1-ethylidene-3-methyl-2-methylidene-4-phenyl-6-propan-2-ylnaphthalene.
| Compound Name | (1E)-1-ethylidene-3-methyl-2-methylidene-4-phenyl-6-propan-2-ylnaphthalene |
|---|---|
| PubChem CID | 145276200 |
| Molecular Formula | C23H24 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | (1E)-1-ethylidene-3-methyl-2-methylidene-4-phenyl-6-propan-2-ylnaphthalene |
| SMILES | C=c1c(C)c(-c2ccccc2)c2cc(C(C)C)ccc2/c1=C/C |
| InChI | InChI=1S/C23H24/c1-6-20-16(4)17(5)23(18-10-8-7-9-11-18)22-14-19(15(2)3)12-13-21(20)22/h6-15H,4H2,1-3,5H3/b20-6+ |
| InChIKey | KITIWZKCQPBRMH-CGOBSMCZSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |