C62H72N2 — CID 145276218
9,10-bis(but-3-enyl)-2-N,7-N-bis[5-methyl-5-(3-methylpentan-3-yl)cyclohepta-1,3,6-trien-1-yl]-2-N,7-N-diphenylphenanthrene-2,7-diamine (PubChem CID 145276218) has the molecular formula C62H72N2 and a molecular weight of 845.27 g/mol. Its IUPAC name is 9,10-bis(but-3-enyl)-2-N,7-N-bis[5-methyl-5-(3-methylpentan-3-yl)cyclohepta-1,3,6-trien-1-yl]-2-N,7-N-diphenylphenanthrene-2,7-diamine.
| Compound Name | 9,10-bis(but-3-enyl)-2-N,7-N-bis[5-methyl-5-(3-methylpentan-3-yl)cyclohepta-1,3,6-trien-1-yl]-2-N,7-N-diphenylphenanthrene-2,7-diamine |
|---|---|
| PubChem CID | 145276218 |
| Molecular Formula | C62H72N2 |
| Molecular Weight | 845.27 g/mol |
| Exact Mass | 844.57 |
| IUPAC Name | 9,10-bis(but-3-enyl)-2-N,7-N-bis[5-methyl-5-(3-methylpentan-3-yl)cyclohepta-1,3,6-trien-1-yl]-2-N,7-N-diphenylphenanthrene-2,7-diamine |
| SMILES | C=CCCc1c(CCC=C)c2cc(N(C3=CC=CC(C)(C(C)(CC)CC)C=C3)c3ccccc3)ccc2c2ccc(N(C3=CC=CC(C)(C(C)(CC)CC)C=C3)c3ccccc3)cc12 |
| InChI | InChI=1S/C62H72N2/c1-11-17-33-53-54(34-18-12-2)58-46-52(64(48-29-23-20-24-30-48)50-32-26-42-62(10,44-40-50)60(8,15-5)16-6)36-38-56(58)55-37-35-51(45-57(53)55)63(47-27-21-19-22-28-47)49-31-25-41-61(9,43-39-49)59(7,13-3)14-4/h11-12,19-32,35-46H,1-2,13-18,33-34H2,3-10H3 |
| InChIKey | YDBGWAQBVNVYMT-UHFFFAOYSA-N |
| XLogP | 18.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.27 |
| LogP ≤ 5 | 18.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|