C56H38F2N6 — CID 145277077
2-[4-[7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,9-difluoro-8a-methyl-8H-fluoren-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 145277077) has the molecular formula C56H38F2N6 and a molecular weight of 832.96 g/mol. Its IUPAC name is 2-[4-[7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,9-difluoro-8a-methyl-8H-fluoren-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,9-difluoro-8a-methyl-8H-fluoren-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 145277077 |
| Molecular Formula | C56H38F2N6 |
| Molecular Weight | 832.96 g/mol |
| Exact Mass | 832.31 |
| IUPAC Name | 2-[4-[7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,9-difluoro-8a-methyl-8H-fluoren-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC12CC(c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)=CC=C1c1ccc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)cc1C2(F)F |
| InChI | InChI=1S/C56H38F2N6/c1-55-35-45(37-24-28-43(29-25-37)54-63-51(40-18-10-4-11-19-40)60-52(64-54)41-20-12-5-13-21-41)31-33-47(55)46-32-30-44(34-48(46)56(55,57)58)36-22-26-42(27-23-36)53-61-49(38-14-6-2-7-15-38)59-50(62-53)39-16-8-3-9-17-39/h2-34H,35H2,1H3 |
| InChIKey | ZDFWICRSCNBGPF-UHFFFAOYSA-N |
| XLogP | 13.71 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.96 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |