C22H36N2 — CID 145280061
1-N-cyclohexyl-2-N-methyl-1-N-(2-methylpropyl)-4-pent-4-en-2-ylbenzene-1,2-diamine (PubChem CID 145280061) has the molecular formula C22H36N2 and a molecular weight of 328.54 g/mol. Its IUPAC name is 1-N-cyclohexyl-2-N-methyl-1-N-(2-methylpropyl)-4-pent-4-en-2-ylbenzene-1,2-diamine.
| Compound Name | 1-N-cyclohexyl-2-N-methyl-1-N-(2-methylpropyl)-4-pent-4-en-2-ylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 145280061 |
| Molecular Formula | C22H36N2 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.29 |
| IUPAC Name | 1-N-cyclohexyl-2-N-methyl-1-N-(2-methylpropyl)-4-pent-4-en-2-ylbenzene-1,2-diamine |
| SMILES | C=CCC(C)c1ccc(N(CC(C)C)C2CCCCC2)c(NC)c1 |
| InChI | InChI=1S/C22H36N2/c1-6-10-18(4)19-13-14-22(21(15-19)23-5)24(16-17(2)3)20-11-8-7-9-12-20/h6,13-15,17-18,20,23H,1,7-12,16H2,2-5H3 |
| InChIKey | PPADQEIAQUCHBJ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|