C29H22F2N2 — CID 145280808
[(4Z)-5-ethenyl-4-ethylidene-1-(4-fluorocyclohexa-2,4-dien-1-yl)-3-(4-fluorophenyl)-1,8b-dihydrocyclopenta[a]inden-2-ylidene]cyanamide (PubChem CID 145280808) has the molecular formula C29H22F2N2 and a molecular weight of 436.51 g/mol. Its IUPAC name is [(4Z)-5-ethenyl-4-ethylidene-1-(4-fluorocyclohexa-2,4-dien-1-yl)-3-(4-fluorophenyl)-1,8b-dihydrocyclopenta[a]inden-2-ylidene]cyanamide.
| Compound Name | [(4Z)-5-ethenyl-4-ethylidene-1-(4-fluorocyclohexa-2,4-dien-1-yl)-3-(4-fluorophenyl)-1,8b-dihydrocyclopenta[a]inden-2-ylidene]cyanamide |
|---|---|
| PubChem CID | 145280808 |
| Molecular Formula | C29H22F2N2 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | [(4Z)-5-ethenyl-4-ethylidene-1-(4-fluorocyclohexa-2,4-dien-1-yl)-3-(4-fluorophenyl)-1,8b-dihydrocyclopenta[a]inden-2-ylidene]cyanamide |
| SMILES | C=Cc1cccc2c1/C(=C\C)C1=C(c3ccc(F)cc3)/C(=N/C#N)C(C3C=CC(F)=CC3)C12 |
| InChI | InChI=1S/C29H22F2N2/c1-3-17-6-5-7-23-24(17)22(4-2)27-25(18-8-12-20(30)13-9-18)29(33-16-32)26(28(23)27)19-10-14-21(31)15-11-19/h3-10,12-15,19,26,28H,1,11H2,2H3/b22-4+,33-29- |
| InChIKey | RVFYYCQJQKGEBP-OIAOBHCLSA-N |
| XLogP | 7.40 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|